CAS 331763-65-6 appears in our catalog under these names: (R)-3-Amino-4-(3-fluorophenyl)butanoic acid hydrochloride, 95%, (R)-3-Amino-4-(3-fluorophenyl)butanoic acid hydrochloride, 98%, (R)–3–Amino–4–(3–fluorophenyl)butanoic acid hydrochloride, (R)-3-Amino-4-(3-fluorophenyl)butanoic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(3R)-3-amino-4-(3-fluorophenyl)butanoic acid;hydrochloride (CAS 331763-65-6) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: (3R)-3-amino-4-(3-fluorophenyl)butanoic acid;hydrochloride. InChIKey: HLJRPTAKNOUJAW-SBSPUUFOSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | (3R)-3-amino-4-(3-fluorophenyl)butanoic acid;hydrochloride |
| InChIKey | HLJRPTAKNOUJAW-SBSPUUFOSA-N |
| SMILES | C1=CC(=CC(=C1)F)C[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)