Products 1214854-04-2

CAS 1214854-04-2 is the registry number for (Dimethylamino)(2-fluorophenyl)acetic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(dimethylamino)-2-(2-fluorophenyl)acetic acid;hydrochloride (CAS 1214854-04-2) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: 2-(dimethylamino)-2-(2-fluorophenyl)acetic acid;hydrochloride. InChIKey: BVCIHIVJCGUPSG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClFNO2
Molecular weight233.67 g/mol
IUPAC name2-(dimethylamino)-2-(2-fluorophenyl)acetic acid;hydrochloride
InChIKeyBVCIHIVJCGUPSG-UHFFFAOYSA-N
SMILESCN(C)C(C1=CC=CC=C1F)C(=O)O.Cl

Computed by PubChem (NCBI)