CAS 2060042-34-2 appears in our catalog under these names: 2-Amino-3-(4-fluorophenyl)-2-methylpropanoic acid hydrochloride, 2-amino-3-(4-fluorophenyl)-2-methylpropanoic acid hydrochloride, 95%, 2-Amino-3-(4-fluorophenyl)-2-methylpropanoic acid hydrochloride, 98%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
2-amino-3-(4-fluorophenyl)-2-methylpropanoic acid;hydrochloride (CAS 2060042-34-2) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: 2-amino-3-(4-fluorophenyl)-2-methylpropanoic acid;hydrochloride. InChIKey: VMTAAZCQJVQKFU-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | 2-amino-3-(4-fluorophenyl)-2-methylpropanoic acid;hydrochloride |
| InChIKey | VMTAAZCQJVQKFU-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)F)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)