CAS 176896-71-2 appears in our catalog under these names: Methyl (2R)-2-amino-3-(2-fluorophenyl)propanoate hydrochloride, 98%, Methyl (2R)-2-amino-3-(2-fluorophenyl)propanoate hydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.
Methyl (2R)-2-amino-3-(2-fluorophenyl)propanoate;hydrochloride (CAS 176896-71-2) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: methyl (2R)-2-amino-3-(2-fluorophenyl)propanoate;hydrochloride. InChIKey: QTBXLWIDAKRUBJ-SBSPUUFOSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(2-fluorophenyl)propanoate;hydrochloride |
| InChIKey | QTBXLWIDAKRUBJ-SBSPUUFOSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=CC=C1F)N.Cl |
Computed by PubChem (NCBI)