cas: 123053-22-5 — see every product listed under this CAS number, including other names
(S)-2-Amino-3-(3-chlorophenyl)propanoic acid hydrochloride, 97%, 97% (CAS 123053-22-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111K1K-100mg |
| cas | 123053-22-5 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 386.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride (CAS 123053-22-5) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: (2S)-2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride. InChIKey: MLKORXUFSMVSBB-QRPNPIFTSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | (2S)-2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride |
| InChIKey | MLKORXUFSMVSBB-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)