cas: 97534-82-2 — see every product listed under this CAS number, including other names
(S)-3-((Benzyloxy)carbonyl)oxazolidine-4-carboxylic acid 98% (CAS 97534-82-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A833086-10g |
| cas | 97534-82-2 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1950.12 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 1115.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A833086 |
(4S)-3-phenylmethoxycarbonyl-1,3-oxazolidine-4-carboxylic acid (CAS 97534-82-2) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: (4S)-3-phenylmethoxycarbonyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: XRRRGBIMHQARMF-JTQLQIEISA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (4S)-3-phenylmethoxycarbonyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | XRRRGBIMHQARMF-JTQLQIEISA-N |
| SMILES | C1[C@H](N(CO1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)