Products 82933-21-9
CAS 82933-21-9 is the registry number for Bz-asp-ome, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3S)-3-benzamido-4-methoxy-4-oxobutanoic acid (CAS 82933-21-9) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: (3S)-3-benzamido-4-methoxy-4-oxobutanoic acid. InChIKey: QKUIURWOJPUEOY-VIFPVBQESA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (3S)-3-benzamido-4-methoxy-4-oxobutanoic acid |
| InChIKey | QKUIURWOJPUEOY-VIFPVBQESA-N |
| SMILES | COC(=O)[C@H](CC(=O)O)NC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
BZ-ASP-OME, (S)-3-Benzamido-4-methoxy-4-oxobutanoic acid, (3S)-3-benzamido-4-methoxy-4-oxobutanoic acid, (3S)-3-benzamido-4-methoxy-4-oxo-butanoic Acid, (S)-3-Benzamido-4-methoxy-4-oxobutanoicacid, BENZOYL-L-ASPARTIC ACID A-METHYL ESTER, BenZoyl-L-aspartic acid alpha- methyl ester (BZ-L-Asp-OMe)