cas: 97534-82-2 — see every product listed under this CAS number, including other names
(S)-3-((Benzyloxy)carbonyl)oxazolidine-4-carboxylic acid, 95%, 95% (CAS 97534-82-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CDT-100mg |
| cas | 97534-82-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 1355.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4S)-3-phenylmethoxycarbonyl-1,3-oxazolidine-4-carboxylic acid (CAS 97534-82-2) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: (4S)-3-phenylmethoxycarbonyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: XRRRGBIMHQARMF-JTQLQIEISA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (4S)-3-phenylmethoxycarbonyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | XRRRGBIMHQARMF-JTQLQIEISA-N |
| SMILES | C1[C@H](N(CO1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)