CAS 30448-09-0 is the registry number for 4,5,6-Trimethoxy-1h-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
4,5,6-trimethoxy-1H-indole-2-carboxylic acid (CAS 30448-09-0) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 4,5,6-trimethoxy-1H-indole-2-carboxylic acid. InChIKey: PRUGUKSHOAAIBD-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 4,5,6-trimethoxy-1H-indole-2-carboxylic acid |
| InChIKey | PRUGUKSHOAAIBD-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C=C(NC2=C1)C(=O)O)OC)OC |
Computed by PubChem (NCBI)