CAS 161156-01-0 is the registry number for 4,6,7-Trimethoxy-1h-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4,6,7-trimethoxy-1H-indole-2-carboxylic acid (CAS 161156-01-0) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 4,6,7-trimethoxy-1H-indole-2-carboxylic acid. InChIKey: QVCJMJQXKVYHCL-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 4,6,7-trimethoxy-1H-indole-2-carboxylic acid |
| InChIKey | QVCJMJQXKVYHCL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C2=C1C=C(N2)C(=O)O)OC)OC |
Computed by PubChem (NCBI)