CAS 62088-12-4 appears in our catalog under these names: Ethyl 4-(4-nitrophenyl)-3-oxobutanoate, 97%, 4–(4–nitro–phenyl)–3–oxo–butyric acid ethyl ester, 4-(4-Nitro-phenyl)-3-oxo-butyric acid ethyl ester, 95%. Offered by: AmBeed, GLPBio, Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
Ethyl 4-(4-nitrophenyl)-3-oxobutanoate (CAS 62088-12-4) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: ethyl 4-(4-nitrophenyl)-3-oxobutanoate. InChIKey: UUTYXRRHMODSGX-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | ethyl 4-(4-nitrophenyl)-3-oxobutanoate |
| InChIKey | UUTYXRRHMODSGX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)CC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)