CAS 1379811-81-0 appears in our catalog under these names: 3-(((Benzyloxy)carbonyl)amino)oxetane-3-carboxylic acid, 95%, 3–(((Benzyloxy)carbonyl)amino)oxetane–3–carboxylic acid, 3-(((benzyloxy)carbonyl)amino)oxetane-3-carboxylic acid, 3-(((Benzyloxy)carbonyl)amino)oxetane-3-carboxylic acid 95%, 3-(((Benzyloxy)carbonyl)amino)oxetane-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g, 500mg, 25g.
3-(phenylmethoxycarbonylamino)oxetane-3-carboxylic acid (CAS 1379811-81-0) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 3-(phenylmethoxycarbonylamino)oxetane-3-carboxylic acid. InChIKey: SDACJLQSZZYSTE-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 3-(phenylmethoxycarbonylamino)oxetane-3-carboxylic acid |
| InChIKey | SDACJLQSZZYSTE-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)