CAS 6094-36-6 appears in our catalog under these names: Bz-glu-oh, 98%, Bz–Glu–OH, N-Benzoyl-L-glutamic Acid, >98.0%(HPLC)(T), Benzoyl-L-glutamic acid, Bz-Glu-OH, ≥98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g.
(2S)-2-benzamidopentanedioic acid (CAS 6094-36-6) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: (2S)-2-benzamidopentanedioic acid. InChIKey: LPJXPACOXRZCCP-VIFPVBQESA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (2S)-2-benzamidopentanedioic acid |
| InChIKey | LPJXPACOXRZCCP-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)