(S)-3-Acetoxy-4-ethoxy-4-oxobutyric Acid, ≥95%
cas: 52485-05-9 — see every product listed under this CAS number, including other names
(S)-3-Acetoxy-4-ethoxy-4-oxobutyric Acid, ≥95% (CAS 52485-05-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11E3IO-100mg |
| cas | 52485-05-9 |
| size | 100mg |
| availability | 100g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 717.20 Pln | |
| Chemat | 5g | 1682.00 Pln | |
| Chemat | 10g | 2474.00 Pln | |
| Chemat | 25g | 5229.20 Pln | |
| Fluorochem | 100mg | 883.04 Pln | |
| Fluorochem | 250mg | 1013.20 Pln | |
| Fluorochem | 1g | 1325.59 Pln | |
| Fluorochem | 5g | 3137.45 Pln | |
| Fluorochem | 10g | 4584.86 Pln | |
| Fluorochem | 25g | 9536.24 Pln |
properties
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-acetyloxy-4-ethoxy-4-oxobutanoic acid (CAS 52485-05-9) is a chemical compound with the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. IUPAC name: (3S)-3-acetyloxy-4-ethoxy-4-oxobutanoic acid. InChIKey: LEYRJIGDJYRCMY-LURJTMIESA-N.
| Molecular formula | C8H12O6 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | (3S)-3-acetyloxy-4-ethoxy-4-oxobutanoic acid |
| InChIKey | LEYRJIGDJYRCMY-LURJTMIESA-N |
| SMILES | CCOC(=O)[C@H](CC(=O)O)OC(=O)C |
Computed by PubChem (NCBI)