Products 412018-73-6

CAS 412018-73-6 is the registry number for 1-Ethyl 4-Methyl 3-Methoxy-2-oxosuccinate. Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

1-O-ethyl 4-O-methyl 3-methoxy-2-oxobutanedioate (CAS 412018-73-6) is a chemical compound with the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. IUPAC name: 1-O-ethyl 4-O-methyl 3-methoxy-2-oxobutanedioate. InChIKey: BSQGOYSFFQGXIN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12O6
Molecular weight204.18 g/mol
IUPAC name1-O-ethyl 4-O-methyl 3-methoxy-2-oxobutanedioate
InChIKeyBSQGOYSFFQGXIN-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)C(C(=O)OC)OC

Computed by PubChem (NCBI)