CAS 1613297-04-3 is the registry number for Iopromide Impurity 50. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[(2S)-2-acetyloxypropanoyl]oxypropanoic acid (CAS 1613297-04-3) is a chemical compound with the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. IUPAC name: (2S)-2-[(2S)-2-acetyloxypropanoyl]oxypropanoic acid. InChIKey: ZMZNKKBJSVZLKK-WHFBIAKZSA-N.
| Molecular formula | C8H12O6 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | (2S)-2-[(2S)-2-acetyloxypropanoyl]oxypropanoic acid |
| InChIKey | ZMZNKKBJSVZLKK-WHFBIAKZSA-N |
| SMILES | C[C@@H](C(=O)O)OC(=O)[C@H](C)OC(=O)C |
Computed by PubChem (NCBI)