CAS 52485-05-9 appears in our catalog under these names: (S)-3-Acetoxy-4-ethoxy-4-oxobutyric acid, 95%, (S)-3-Acetoxy-4-ethoxy-4-oxobutyric Acid, ≥95%, ≥95%, (S)-3-ACETOXY-4-ETHOXY-4-OXOBUTYRIC ACID, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 100mg, 250mg.
(3S)-3-acetyloxy-4-ethoxy-4-oxobutanoic acid (CAS 52485-05-9) is a chemical compound with the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. IUPAC name: (3S)-3-acetyloxy-4-ethoxy-4-oxobutanoic acid. InChIKey: LEYRJIGDJYRCMY-LURJTMIESA-N.
| Molecular formula | C8H12O6 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | (3S)-3-acetyloxy-4-ethoxy-4-oxobutanoic acid |
| InChIKey | LEYRJIGDJYRCMY-LURJTMIESA-N |
| SMILES | CCOC(=O)[C@H](CC(=O)O)OC(=O)C |
Computed by PubChem (NCBI)