Products 1276197-30-8
CAS 1276197-30-8 appears in our catalog under these names: Endothall-3,4,4,5,5,6-d6 Monohydrate (d6 Major), >95% (HPLC), Endothall-3,4,4,5,5,6-d6 Monohydrate, >95% (HPLC), Endothall-3,4,4,5,5,6-d6 H2O, 93 atom % D, min 98% Chemical Purity, Endothall-3,4,4,5,5,6 H2O-d6. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 500 μg, 5 mg, 1 mg.
1,4,5,5,6,6-hexadeuterio-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate (CAS 1276197-30-8) is a chemical compound with the molecular formula C8H12O6 and a molecular weight of 210.21 g/mol. IUPAC name: 1,4,5,5,6,6-hexadeuterio-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate. InChIKey: RHLALKDQINFLPM-MIHIASBFSA-N.
| Molecular formula | C8H12O6 |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 1,4,5,5,6,6-hexadeuterio-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate |
| InChIKey | RHLALKDQINFLPM-MIHIASBFSA-N |
| SMILES | [2H]C1(C(C2(C(C(C1(O2)[2H])C(=O)O)C(=O)O)[2H])([2H])[2H])[2H].O |
Computed by PubChem (NCBI)