CAS 67812-33-3 appears in our catalog under these names: (4R,5R)-5-(Methoxycarbonyl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid, 98%, (4R,5R)-5-(Methoxycarbonyl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 2g, 5g.
(4R,5R)-5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (CAS 67812-33-3) is a chemical compound with the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. IUPAC name: (4R,5R)-5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid. InChIKey: QDCLIEXYHDLWGC-RFZPGFLSSA-N.
| Molecular formula | C8H12O6 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | (4R,5R)-5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| InChIKey | QDCLIEXYHDLWGC-RFZPGFLSSA-N |
| SMILES | CC1(O[C@H]([C@@H](O1)C(=O)OC)C(=O)O)C |
Computed by PubChem (NCBI)