CAS 37140-30-0 is the registry number for 3-Carboxyheptanedioic Acid. Offered by: TRC. Available pack sizes: 500mg.
Pentane-1,2,5-tricarboxylic acid (CAS 37140-30-0) is a chemical compound with the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. IUPAC name: pentane-1,2,5-tricarboxylic acid. InChIKey: TXYVAFSOOYMQRP-UHFFFAOYSA-N.
| Molecular formula | C8H12O6 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | pentane-1,2,5-tricarboxylic acid |
| InChIKey | TXYVAFSOOYMQRP-UHFFFAOYSA-N |
| SMILES | C(CC(CC(=O)O)C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)