CAS 77370-41-3 appears in our catalog under these names: 3-Methylbutane-1,2,3-tricarboxylic acid, 98%, 3-Methylbutane-1,2,3-tricarboxylic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10g, 1g.
3-methylbutane-1,2,3-tricarboxylic acid (CAS 77370-41-3) is a chemical compound with the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. IUPAC name: 3-methylbutane-1,2,3-tricarboxylic acid. InChIKey: VMWJGTKDJFMTFZ-UHFFFAOYSA-N.
| Molecular formula | C8H12O6 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3-methylbutane-1,2,3-tricarboxylic acid |
| InChIKey | VMWJGTKDJFMTFZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(CC(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)