cas: 714230-22-5 — see every product listed under this CAS number, including other names
(S)-Methyl 3-(aminomethyl)-5-methylhexanoate hydrochloride, 95%, 95% (CAS 714230-22-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FDKW-100mg |
| cas | 714230-22-5 |
| size | 100mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 587.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride (CAS 714230-22-5) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: methyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride. InChIKey: NQNJFRLJTFCGSL-QRPNPIFTSA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | methyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
| InChIKey | NQNJFRLJTFCGSL-QRPNPIFTSA-N |
| SMILES | CC(C)C[C@@H](CC(=O)OC)CN.Cl |
Computed by PubChem (NCBI)