cas: 714230-22-5 — see every product listed under this CAS number, including other names
(S)-Pregabalin methyl ester (hydrochloride), 95.0% (CAS 714230-22-5) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g, 500 mg, 1 g, 100 mg, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W101682-10 g |
| cas | 714230-22-5 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 3115.38 Pln | |
| MedChemExpress | 5 g | 1991.53 Pln | |
| MedChemExpress | 500 mg | 589.04 Pln | |
| MedChemExpress | 1 g | 867.68 Pln | |
| MedChemExpress | 100 mg | 268.61 Pln | |
| MedChemExpress | 250 mg | 417.22 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 95.0% |
Methyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride (CAS 714230-22-5) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: methyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride. InChIKey: NQNJFRLJTFCGSL-QRPNPIFTSA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | methyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
| InChIKey | NQNJFRLJTFCGSL-QRPNPIFTSA-N |
| SMILES | CC(C)C[C@@H](CC(=O)OC)CN.Cl |
Computed by PubChem (NCBI)