Products 1379444-89-9
CAS 1379444-89-9 appears in our catalog under these names: tert-butyl (2r)-2-aminopentanoate hydrochloride, 95%, tert-Butyl (R)-2-aminopentanoate hydrochloride, 98%, H-D-Nva-OtBu*HCl. Offered by: Combi-blocks, AmBeed, Iris Biotech. Available pack sizes: 10g, 5g, 1g, 250mg, 500mg.
Tert-butyl (2R)-2-aminopentanoate;hydrochloride (CAS 1379444-89-9) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: tert-butyl (2R)-2-aminopentanoate;hydrochloride. InChIKey: YQHANSSYWITJHA-OGFXRTJISA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | tert-butyl (2R)-2-aminopentanoate;hydrochloride |
| InChIKey | YQHANSSYWITJHA-OGFXRTJISA-N |
| SMILES | CCC[C@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)