CAS 714230-22-5 appears in our catalog under these names: Pregabalin methyl ester (hydrochloride), Pregabalin Methyl Ester HCl, (S)-Pregabalin Methyl Ester Hydrochloride Salt, >95% (HPLC), Pregabalin Methyl Ester Hydrochloride, (S)-Pregabalin methyl ester. Offered by: GLPBio, Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: 5mg, on request, 10mg, 25mg, 100mg, 1mg, 50mg, 250mg.
Methyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride (CAS 714230-22-5) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: methyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride. InChIKey: NQNJFRLJTFCGSL-QRPNPIFTSA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | methyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
| InChIKey | NQNJFRLJTFCGSL-QRPNPIFTSA-N |
| SMILES | CC(C)C[C@@H](CC(=O)OC)CN.Cl |
Computed by PubChem (NCBI)