Products 2203071-74-1

CAS 2203071-74-1 is the registry number for 3-Diethylamino-2,2-dimethyl-propionic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(diethylamino)-2,2-dimethylpropanoic acid;hydrochloride (CAS 2203071-74-1) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: 3-(diethylamino)-2,2-dimethylpropanoic acid;hydrochloride. InChIKey: BHXOVCNYCPAEQX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H20ClNO2
Molecular weight209.71 g/mol
IUPAC name3-(diethylamino)-2,2-dimethylpropanoic acid;hydrochloride
InChIKeyBHXOVCNYCPAEQX-UHFFFAOYSA-N
SMILESCCN(CC)CC(C)(C)C(=O)O.Cl

Computed by PubChem (NCBI)