Products 864871-52-3

CAS 864871-52-3 is the registry number for Ethyl 3-amino-5-methylhexanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3-amino-5-methylhexanoate;hydrochloride (CAS 864871-52-3) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: ethyl 3-amino-5-methylhexanoate;hydrochloride. InChIKey: AIHZNXKXHTVWJP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H20ClNO2
Molecular weight209.71 g/mol
IUPAC nameethyl 3-amino-5-methylhexanoate;hydrochloride
InChIKeyAIHZNXKXHTVWJP-UHFFFAOYSA-N
SMILESCCOC(=O)CC(CC(C)C)N.Cl

Computed by PubChem (NCBI)