CAS 13518-40-6 appears in our catalog under these names: H–Val–OtBu?HCl, H-L-Val-OtBu*HCl, L-Valine tert-butyl ester hydrochloride, L-Valine tert-Butyl Ester Hydrochloride, >98.0%(N)(T), L-Valine tert-butyl Ester Hydrochloride, 97%, 97%. Offered by: GLPBio, Iris Biotech, Biosynth, TCI, Chemat. Available pack sizes: 25g, 5g, 50g, 100g, 500g, 250g, 1g, 10g.
Tert-butyl (2S)-2-amino-3-methylbutanoate;hydrochloride (CAS 13518-40-6) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-methylbutanoate;hydrochloride. InChIKey: AUIVQIHTTVPKFS-FJXQXJEOSA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-methylbutanoate;hydrochloride |
| InChIKey | AUIVQIHTTVPKFS-FJXQXJEOSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)