CAS 62621-18-5 appears in our catalog under these names: Propan-2-yl (2s)-2-amino-4-methylpentanoate hydrochloride, 95%, (S)-Isopropyl 2-amino-4-methylpentanoate hydrochloride, 95%, Propan-2-yl (2S)-2-amino-4-methylpentanoate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Propan-2-yl (2S)-2-amino-4-methylpentanoate;hydrochloride (CAS 62621-18-5) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: propan-2-yl (2S)-2-amino-4-methylpentanoate;hydrochloride. InChIKey: XKTHEYZJHAEELX-QRPNPIFTSA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | propan-2-yl (2S)-2-amino-4-methylpentanoate;hydrochloride |
| InChIKey | XKTHEYZJHAEELX-QRPNPIFTSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC(C)C)N.Cl |
Computed by PubChem (NCBI)