CAS 1391379-45-5 appears in our catalog under these names: Methyl (3S)-3-amino-3-(3-bromophenyl)propanoate hydrochloride, (S)-Methyl 3-amino-3-(3-bromophenyl)propanoate hydrochloride, 97%, 97%, (S)-METHYL 3-AMINO-3-(3-BROMOPHENYL)PROPANOATE HCL, 97%, (S)-Methyl 3-amino-3-(3-bromophenyl)propanoate hydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 2,5g, 100mg, 5g, 1g.
Methyl (3S)-3-amino-3-(3-bromophenyl)propanoate;hydrochloride (CAS 1391379-45-5) is a chemical compound with the molecular formula C10H13BrClNO2 and a molecular weight of 294.57 g/mol. IUPAC name: methyl (3S)-3-amino-3-(3-bromophenyl)propanoate;hydrochloride. InChIKey: PKCPLSGPTCTEMS-FVGYRXGTSA-N.
| Molecular formula | C10H13BrClNO2 |
|---|---|
| Molecular weight | 294.57 g/mol |
| IUPAC name | methyl (3S)-3-amino-3-(3-bromophenyl)propanoate;hydrochloride |
| InChIKey | PKCPLSGPTCTEMS-FVGYRXGTSA-N |
| SMILES | COC(=O)C[C@@H](C1=CC(=CC=C1)Br)N.Cl |
Computed by PubChem (NCBI)