Products 1820705-24-5
CAS 1820705-24-5 is the registry number for methyl 2-bromo-5-(dimethylamino)benzoate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.
Methyl 2-bromo-5-(dimethylamino)benzoate;hydrochloride (CAS 1820705-24-5) is a chemical compound with the molecular formula C10H13BrClNO2 and a molecular weight of 294.57 g/mol. IUPAC name: methyl 2-bromo-5-(dimethylamino)benzoate;hydrochloride. InChIKey: YAGCOQUYJCNMFC-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClNO2 |
|---|---|
| Molecular weight | 294.57 g/mol |
| IUPAC name | methyl 2-bromo-5-(dimethylamino)benzoate;hydrochloride |
| InChIKey | YAGCOQUYJCNMFC-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)Br)C(=O)OC.Cl |
Computed by PubChem (NCBI)