Products 189892-26-0
CAS 189892-26-0 is the registry number for methyl 2-amino-3-(3-bromophenyl)propanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Methyl 2-amino-3-(3-bromophenyl)propanoate;hydrochloride (CAS 189892-26-0) is a chemical compound with the molecular formula C10H13BrClNO2 and a molecular weight of 294.57 g/mol. IUPAC name: methyl 2-amino-3-(3-bromophenyl)propanoate;hydrochloride. InChIKey: CQDQJGWBVXXNCB-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClNO2 |
|---|---|
| Molecular weight | 294.57 g/mol |
| IUPAC name | methyl 2-amino-3-(3-bromophenyl)propanoate;hydrochloride |
| InChIKey | CQDQJGWBVXXNCB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC(=CC=C1)Br)N.Cl |
Computed by PubChem (NCBI)