(S)-Methyl 3-amino-4-phenylbutanoate hydrochloride, 96%, 96%
cas: 186393-25-9 — see every product listed under this CAS number, including other names
(S)-Methyl 3-amino-4-phenylbutanoate hydrochloride, 96%, 96% (CAS 186393-25-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I2RB-100mg |
| cas | 186393-25-9 |
| size | 100mg |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 746.00 Pln | |
| Chemat | 1g | 1902.80 Pln | |
| Chemat | 5g | 7422.80 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl (3S)-3-amino-4-phenylbutanoate;hydrochloride (CAS 186393-25-9) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: methyl (3S)-3-amino-4-phenylbutanoate;hydrochloride. InChIKey: AQIIBDWIBUUNCO-PPHPATTJSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | methyl (3S)-3-amino-4-phenylbutanoate;hydrochloride |
| InChIKey | AQIIBDWIBUUNCO-PPHPATTJSA-N |
| SMILES | COC(=O)C[C@H](CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-Methyl 3-amino-4-phenylbutanoate hydrochloride, methyl (3S)-3-amino-4-phenylbutanoate;hydrochloride, L-Beta-homophenylalanine methyl ester, HCl, L-Beta-homophenylalanine methyl ester, HCl, Benzenebutanoic acid, b-amino-, methyl ester, hydrochloride, (bS)-, (S)-Methyl3-amino-4-phenylbutanoatehydrochloride, L-Beta-homophenylalanine methyl ester hydrochloride, methyl (3S)-3-amino-4-phenyl-butanoate;hydrochloride