CAS 186393-25-9 appears in our catalog under these names: L-Beta-homophenylalanine methyl ester hydrochloride, 96%, Methyl (3S)-3-amino-4-phenylbutanoate hydrochloride, (S)-Methyl 3-amino-4-phenylbutanoate hydrochloride, 96%, 96%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 5g, 0,5g, 0,25g, 2g, 100mg, 250mg.
Methyl (3S)-3-amino-4-phenylbutanoate;hydrochloride (CAS 186393-25-9) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: methyl (3S)-3-amino-4-phenylbutanoate;hydrochloride. InChIKey: AQIIBDWIBUUNCO-PPHPATTJSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | methyl (3S)-3-amino-4-phenylbutanoate;hydrochloride |
| InChIKey | AQIIBDWIBUUNCO-PPHPATTJSA-N |
| SMILES | COC(=O)C[C@H](CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)