cas: 175453-08-4 — see every product listed under this CAS number, including other names
(S)-N-Fmoc-4-Chlorophenylalanine, 98%, 98% (CAS 175453-08-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1131ZP-1g |
| cas | 175453-08-4 |
| size | 1g |
| availability | 900.07g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 198.80 Pln | |
| Chemat | 50g | 333.20 Pln | |
| Chemat | 100g | 597.20 Pln | |
| Chemat | 250g | 1302.80 Pln | |
| Chemat | 500g | 2476.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 175453-08-4) is a chemical compound with the molecular formula C24H20ClNO4 and a molecular weight of 421.9 g/mol. IUPAC name: (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: CQPNKLNINBUUOM-QFIPXVFZSA-N.
| Molecular formula | C24H20ClNO4 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | CQPNKLNINBUUOM-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)Cl)C(=O)O |
Computed by PubChem (NCBI)