cas: 175453-08-4 — see every product listed under this CAS number, including other names
Fmoc-Phe(4-Cl)-OH 97% (CAS 175453-08-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A623430-1g |
| cas | 175453-08-4 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 437.12 Pln | |
| Ambeed | 100g | 681.88 Pln | |
| Ambeed | 500g | 3123.81 Pln | |
| Ambeed | 1000g | 6166.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A623430 |
(2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 175453-08-4) is a chemical compound with the molecular formula C24H20ClNO4 and a molecular weight of 421.9 g/mol. IUPAC name: (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: CQPNKLNINBUUOM-QFIPXVFZSA-N.
| Molecular formula | C24H20ClNO4 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | (2S)-3-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | CQPNKLNINBUUOM-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)Cl)C(=O)O |
Computed by PubChem (NCBI)