Products 2936-25-6
CAS 2936-25-6 appears in our catalog under these names: (±)-Muscarine Chloride, (+/-)-Muscarine Chloride, (±)-Muscarine chloride, (±)-Muscarine (chloride). Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 100mg, Get quote.
[(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium chloride (CAS 2936-25-6) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium chloride. InChIKey: WUFRNEJYZWHXLC-CTERPIQNSA-M.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium chloride |
| InChIKey | WUFRNEJYZWHXLC-CTERPIQNSA-M |
| SMILES | C[C@H]1[C@@H](C[C@H](O1)C[N+](C)(C)C)O.[Cl-] |
Computed by PubChem (NCBI)