cas: 669713-92-2 — see every product listed under this CAS number, including other names
[(tert-butoxycarbonyl)amino](3-chlorophenyl)acetic acid, 99.01% (CAS 669713-92-2) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 25 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-78105-10 g |
| cas | 669713-92-2 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 1081.31 Pln | |
| MedChemExpress | 25 g | 1917.23 Pln | |
| MedChemExpress | 5 g | 719.08 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.01% |
2-(3-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 669713-92-2) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: 2-(3-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: BGMKFLAFNZFBBB-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO4 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | BGMKFLAFNZFBBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)