[1,1':4',1''-Terphenyl]-2'-amine, 98%
cas: 25176-17-4 — see every product listed under this CAS number, including other names
[1,1':4',1''-Terphenyl]-2'-amine, 98% (CAS 25176-17-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2251602-1g |
| cas | 25176-17-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 431.56 Pln | |
| Ambeed | 10g | 704.12 Pln | |
| Ambeed | 25g | 1293.75 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 299.60 Pln | |
| Chemat | 10g | 491.60 Pln | |
| Chemat | 25g | 894.80 Pln | |
| BLDpharm | 1g | 181.07 Pln | |
| BLDpharm | 5g | 425.43 Pln | |
| BLDpharm | 10g | 692.00 Pln | |
| BLDpharm | 25g | 1269.58 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,5-diphenylaniline (CAS 25176-17-4) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: 2,5-diphenylaniline. InChIKey: NCLGCNZJCGGRIX-UHFFFAOYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | 2,5-diphenylaniline |
| InChIKey | NCLGCNZJCGGRIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)