cas: 482-05-3 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-2,2'-dicarboxylic acid, 98%, 98% (CAS 482-05-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 500g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114F0M-1g |
| cas | 482-05-3 |
| size | 1g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 500g | 1776.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 395.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Diphenic acid is a dicarboxylic acid. It is a conjugate acid of a diphenate(1-). It derives from a hydride of a biphenyl.
Source: ChEBI
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 2-(2-carboxyphenyl)benzoic acid |
| InChIKey | GWZCCUDJHOGOSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)