CAS 50493-39-5 appears in our catalog under these names: 1,3-Dihydroxy-5-methyl-9h-xanthen-9-one, 95%, 1,3-Dihydroxy-5-methyl-9H-xanthen-9-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1,3-dihydroxy-5-methylxanthen-9-one (CAS 50493-39-5) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 1,3-dihydroxy-5-methylxanthen-9-one. InChIKey: KRVDRUAUZUPZQV-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 1,3-dihydroxy-5-methylxanthen-9-one |
| InChIKey | KRVDRUAUZUPZQV-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)C3=C(C=C(C=C3O2)O)O |
Computed by PubChem (NCBI)