cas: 606-75-7 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-2,3'-dicarboxylic acid, 96% (CAS 606-75-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F931770-250MG |
| cas | 606-75-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 1g | 1486.99 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-carboxyphenyl)benzoic acid (CAS 606-75-7) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 2-(3-carboxyphenyl)benzoic acid. InChIKey: OFKNLQSJUCXVRY-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 2-(3-carboxyphenyl)benzoic acid |
| InChIKey | OFKNLQSJUCXVRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)