cas: 50850-94-7 — see every product listed under this CAS number, including other names
[1,3]Dioxolo[4',5':4,5]benzo[1,2-d]thiazol-6-amine, 97%, 97% (CAS 50850-94-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DJ0D-100mg |
| cas | 50850-94-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 1365.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine (CAS 50850-94-7) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: [1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine. InChIKey: GAIRHYOGMGDIGP-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | [1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine |
| InChIKey | GAIRHYOGMGDIGP-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)N=C(S3)N |
Computed by PubChem (NCBI)