CAS 731742-58-8 appears in our catalog under these names: 2-Mercapto-1h-benzo[d]imidazole-4-carboxylic acid, 95%, 2–Thioxo–2,3–dihydro–1H–benzo(d)imidazole–4–carboxylic acid, 2-Thioxo-2,3-dihydro-1H-benzo[d]imidazole-4-carboxylic acid, 98%, 98%, 2-Thioxo-2,3-dihydro-1H-benzo[d]imidazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxylic acid (CAS 731742-58-8) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxylic acid. InChIKey: OMHCHRXJJPSEBZ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxylic acid |
| InChIKey | OMHCHRXJJPSEBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=S)N2)C(=O)O |
Computed by PubChem (NCBI)