Products 1029108-69-7

CAS 1029108-69-7 appears in our catalog under these names: 3-(3-Thienyl)-1h-pyrazole-5-carboxylic acid, 95%, 5-(thiophen-3-yl)-1H-pyrazole-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.

Structural formula: {0} (CAS {1})

3-thiophen-3-yl-1H-pyrazole-5-carboxylic acid (CAS 1029108-69-7) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 3-thiophen-3-yl-1H-pyrazole-5-carboxylic acid. InChIKey: QUKDMAFMSJBIPR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6N2O2S
Molecular weight194.21 g/mol
IUPAC name3-thiophen-3-yl-1H-pyrazole-5-carboxylic acid
InChIKeyQUKDMAFMSJBIPR-UHFFFAOYSA-N
SMILESC1=CSC=C1C2=NNC(=C2)C(=O)O

Computed by PubChem (NCBI)