CAS 50850-94-7 appears in our catalog under these names: [1,3]Dioxolo[4',5':4,5]benzo[1,2-d]thiazol-6-ylamine, 95%, 4,6-Dioxa-10-thia-12-azatricyclo(7.3.0.0,3,7)dodeca-1,3(7),8,11-tetraen-11-amine, [1,3]Dioxolo[4',5':4,5]benzo[1,2-d]thiazol-6-amine 97%, [1,3]Dioxolo[4',5':4,5]benzo[1,2-d]thiazol-6-amine, 97%, 97%, [1,3]Dioxolo[4',5':4,5]benzo[1,2-d]thiazol-6-ylamine, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 2,5g, 100mg.
[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine (CAS 50850-94-7) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: [1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine. InChIKey: GAIRHYOGMGDIGP-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | [1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine |
| InChIKey | GAIRHYOGMGDIGP-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)N=C(S3)N |
Computed by PubChem (NCBI)