CAS 903173-81-9 is the registry number for 2-(1H-Pyrrol-1-yl)-1,3-thiazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid (CAS 903173-81-9) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid. InChIKey: GQBLTVLHOARDLG-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | GQBLTVLHOARDLG-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)