CAS 903891-96-3 appears in our catalog under these names: 2H-1,4-Benzothiazine-2,3(4H)-dione 3-oxime, 2H-1,4-Benzothiazine-2,3(4h)-dione 3-oxime, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 10g, 1g.
3-(hydroxyamino)-1,4-benzothiazin-2-one (CAS 903891-96-3) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 3-(hydroxyamino)-1,4-benzothiazin-2-one. InChIKey: XGDUYBWNEVQFRU-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 3-(hydroxyamino)-1,4-benzothiazin-2-one |
| InChIKey | XGDUYBWNEVQFRU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(C(=O)S2)NO |
Computed by PubChem (NCBI)