Products 879996-80-2

CAS 879996-80-2 is the registry number for 5-(2-Thienyl)-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-thiophen-2-yl-1H-pyrazole-4-carboxylic acid (CAS 879996-80-2) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 5-thiophen-2-yl-1H-pyrazole-4-carboxylic acid. InChIKey: MICDYEVWWIBWRC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6N2O2S
Molecular weight194.21 g/mol
IUPAC name5-thiophen-2-yl-1H-pyrazole-4-carboxylic acid
InChIKeyMICDYEVWWIBWRC-UHFFFAOYSA-N
SMILESC1=CSC(=C1)C2=C(C=NN2)C(=O)O

Computed by PubChem (NCBI)