CAS 17614-74-3 appears in our catalog under these names: 4-Methyl-2-nitrophenyl isothiocyanate, 95%, 4-Methyl-2-nitrophenyl isothiocyanate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
1-isothiocyanato-4-methyl-2-nitrobenzene (CAS 17614-74-3) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 1-isothiocyanato-4-methyl-2-nitrobenzene. InChIKey: CUQUTWSUXWDJKF-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 1-isothiocyanato-4-methyl-2-nitrobenzene |
| InChIKey | CUQUTWSUXWDJKF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N=C=S)[N+](=O)[O-] |
Computed by PubChem (NCBI)